trichloro-[[4-(chloromethyl)phenyl]methyl]silane structure
|
Common Name | trichloro-[[4-(chloromethyl)phenyl]methyl]silane | ||
|---|---|---|---|---|
| CAS Number | 76371-52-3 | Molecular Weight | 274.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trichloro-[[4-(chloromethyl)phenyl]methyl]silane |
|---|
| Molecular Formula | C8H8Cl4Si |
|---|---|
| Molecular Weight | 274.04700 |
| Exact Mass | 271.91500 |
| LogP | 4.42880 |
| InChIKey | QOUJYSRCDNANNE-UHFFFAOYSA-N |
| SMILES | ClCc1ccc(C[Si](Cl)(Cl)Cl)cc1 |
|
~30%
trichloro-[[4-(... CAS#:76371-52-3 |
| Literature: Korea Institute of Science and Technology Patent: US6392077 B1, 2002 ; |
|
~%
trichloro-[[4-(... CAS#:76371-52-3 |
| Literature: Lefort, Marcel; Simmonet, Christian; Birot, Marc; Deleris, Gerard; Dunogues, Jacques; Calas, Raymond Tetrahedron Letters, 1980 , vol. 21, p. 1857 - 1860 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |