3-Chloro-4-nitropyridine 1-oxide structure
|
Common Name | 3-Chloro-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 76439-45-7 | Molecular Weight | 174.542 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 425.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C5H3ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1±23.2 °C | |
| Name | 3-Chloro-4-nitropyridine N-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 425.5±25.0 °C at 760 mmHg |
| Molecular Formula | C5H3ClN2O3 |
| Molecular Weight | 174.542 |
| Flash Point | 211.1±23.2 °C |
| Exact Mass | 173.983215 |
| PSA | 71.28000 |
| LogP | -0.16 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | MBHLTDWOVIYXEW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])cc1Cl |
|
~33%
3-Chloro-4-nitr... CAS#:76439-45-7 |
| Literature: Caldwell; Martin Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 5 p. 989 - 992 |
|
~%
3-Chloro-4-nitr... CAS#:76439-45-7 |
| Literature: US2003/69257 A1, ; US 20030069257 A1 |
|
~%
3-Chloro-4-nitr... CAS#:76439-45-7 |
| Literature: US2003/69257 A1, ; US 20030069257 A1 |
|
~%
3-Chloro-4-nitr... CAS#:76439-45-7 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 23, p. 785 - 791 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chloro-4-nitropyridine 1-oxide |
| 3-chloro-4-nitro-1-oxidopyridin-1-ium |
| Pyridine, 3-chloro-4-nitro-, 1-oxide |