18-phenyl-1,4,7,10,13,16-hexaoxacyclononadecane-17,19-dione structure
|
Common Name | 18-phenyl-1,4,7,10,13,16-hexaoxacyclononadecane-17,19-dione | ||
|---|---|---|---|---|
| CAS Number | 76461-91-1 | Molecular Weight | 382.40500 | |
| Density | 1.123g/cm3 | Boiling Point | 637ºC at 760 mmHg | |
| Molecular Formula | C19H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278ºC | |
| Name | 18-phenyl-1,4,7,10,13,16-hexaoxacyclononadecane-17,19-dione |
|---|
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 637ºC at 760 mmHg |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.40500 |
| Flash Point | 278ºC |
| Exact Mass | 382.16300 |
| PSA | 89.52000 |
| LogP | 0.93660 |
| Index of Refraction | 1.465 |
| InChIKey | CUMQTPGSWVDOBC-UHFFFAOYSA-N |
| SMILES | O=C1OCCOCCOCCOCCOCCOC(=O)C1c1ccccc1 |
|
~42%
18-phenyl-1,4,7... CAS#:76461-91-1 |
| Literature: Bradshaw, Jerald S.; Jolley, Scott T.; Jones, Brian A. Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 9 p. 1317 - 1318 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |