Kuwanon H structure
|
Common Name | Kuwanon H | ||
|---|---|---|---|---|
| CAS Number | 76472-87-2 | Molecular Weight | 760.82400 | |
| Density | 1.371g/cm3 | Boiling Point | 969.8ºC at 760 mmHg | |
| Molecular Formula | C45H44O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.5ºC | |
Use of Kuwanon HKuwanon H is a flavonoid isolated from Morus bombycis, which acts as a potent non-peptide bombesin receptor antagonist. Kuwanon H selectively inhibits binding of gastrin releasing peptide CRP to GRP-preferring recepotr, with a Ki value of 290 nM in cells[1]. |
| Name | kuwanone H |
|---|---|
| Synonym | More Synonyms |
| Description | Kuwanon H is a flavonoid isolated from Morus bombycis, which acts as a potent non-peptide bombesin receptor antagonist. Kuwanon H selectively inhibits binding of gastrin releasing peptide CRP to GRP-preferring recepotr, with a Ki value of 290 nM in cells[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 290 nM (GRP-preferring recepotr)[1] |
| References |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 969.8ºC at 760 mmHg |
| Molecular Formula | C45H44O11 |
| Molecular Weight | 760.82400 |
| Flash Point | 292.5ºC |
| Exact Mass | 760.28800 |
| PSA | 209.12000 |
| LogP | 8.83870 |
| Index of Refraction | 1.681 |
| InChIKey | DKBPTKFKCCNXNH-QXGWMLRCSA-N |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)C2C(c3c(O)cc(O)c4c(=O)c(CC=C(C)C)c(-c5ccc(O)cc5O)oc34)C=C(C)CC2c2ccc(O)cc2O)c1O |
| Water Solubility | Insuluble (3.5E-6 g/L) (25 ºC) |
| Albanin G |
| Alvanin G |
| kuwanon H |
| Moracenin A |
| NSC 356889 |