15,16-Dir-8(17),11-labdadien-13-one structure
|
Common Name | 15,16-Dir-8(17),11-labdadien-13-one | ||
|---|---|---|---|---|
| CAS Number | 76497-69-3 | Molecular Weight | 260.41 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 343.9±21.0 °C at 760 mmHg | |
| Molecular Formula | C18H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9±15.3 °C | |
Use of 15,16-Dir-8(17),11-labdadien-13-one15,16-Dinor-8(17),11-labdadien-13-one (compound 3) is a compound isolated from the aerial part of Hedychium coronarium[1]. |
| Name | (3E)-4-[(1S,4aS,8aS)-5,5,8a-Trimethyl-2-methylenedecahydro-1-naph thalenyl]-3-buten-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | 15,16-Dinor-8(17),11-labdadien-13-one (compound 3) is a compound isolated from the aerial part of Hedychium coronarium[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.9±21.0 °C at 760 mmHg |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.41 |
| Flash Point | 153.9±15.3 °C |
| Exact Mass | 260.214020 |
| PSA | 17.07000 |
| LogP | 5.88 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | GWLGWWOKIBLQJF-YGUYEABBSA-N |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1C=CC(C)=O |
| Hazard Codes | Xi |
|---|
| 3-Buten-2-one, 4-[(1S,4aS,8aS)-decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl]-, (3E)- |
| (3E)-4-[(1S,4aS,8aS)-5,5,8a-Trimethyl-2-methylenedecahydro-1-naphthalenyl]-3-buten-2-one |