4-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methylcarbamoyl]benzenesulfonyl fluoride structure
|
Common Name | 4-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methylcarbamoyl]benzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 76563-11-6 | Molecular Weight | 453.40200 | |
| Density | 1.88g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H16FN5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[3,4-dihydroxy-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methylcarbamoyl]benzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Molecular Formula | C17H16FN5O7S |
| Molecular Weight | 453.40200 |
| Exact Mass | 453.07500 |
| PSA | 184.88000 |
| LogP | 0.29870 |
| Index of Refraction | 1.784 |
| InChIKey | DVMRGFMUOIRBHE-UHFFFAOYSA-N |
| SMILES | O=C(NCC1OC(n2cnc3c(=O)[nH]cnc32)C(O)C1O)c1ccc(S(=O)(=O)F)cc1 |
|
~44%
4-[[3,4-dihydro... CAS#:76563-11-6 |
| Literature: Elliott, Robert D.; Brockman, R. Wallace; Montgomery, John A. Journal of Medicinal Chemistry, 1981 , vol. 24, # 3 p. 350 - 352 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5'-deoxy-5'-<<4-(fluorosulfonyl)benzoyl>amino>inosine |