3-[3-amino-5-(4-methoxyphenyl)-9-oxo-2,4,8-triazabicyclo[4.3.0]nona-1,3,5-trien-8-yl]propanoic acid structure
|
Common Name | 3-[3-amino-5-(4-methoxyphenyl)-9-oxo-2,4,8-triazabicyclo[4.3.0]nona-1,3,5-trien-8-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76628-76-7 | Molecular Weight | 328.32300 | |
| Density | 1.41g/cm3 | Boiling Point | 723.9ºC at 760 mmHg | |
| Molecular Formula | C16H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.6ºC | |
| Name | 3-[2-amino-4-(4-methoxyphenyl)-7-oxo-5H-pyrrolo[3,4-d]pyrimidin-6-yl]propanoic acid |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 723.9ºC at 760 mmHg |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.32300 |
| Flash Point | 391.6ºC |
| Exact Mass | 328.11700 |
| PSA | 118.64000 |
| LogP | 1.68400 |
| Index of Refraction | 1.648 |
| InChIKey | AJFWNCANXQPRLI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(N)nc3c2CN(CCC(=O)O)C3=O)cc1 |
|
~31%
3-[3-amino-5-(4... CAS#:76628-76-7 |
| Literature: Madhav; Snyder; Southwick Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 6 p. 1231 - 1235 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |