3-[4-[(4-methoxyphenyl)methylidene]-2,3-dioxo-pyrrolidin-1-yl]propanoic acid structure
|
Common Name | 3-[4-[(4-methoxyphenyl)methylidene]-2,3-dioxo-pyrrolidin-1-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76628-84-7 | Molecular Weight | 289.28300 | |
| Density | 1.356g/cm3 | Boiling Point | 524.7ºC at 760 mmHg | |
| Molecular Formula | C15H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 3-[4-[(4-methoxyphenyl)methylidene]-2,3-dioxopyrrolidin-1-yl]propanoic acid |
|---|
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760 mmHg |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.28300 |
| Flash Point | 271.1ºC |
| Exact Mass | 289.09500 |
| PSA | 83.91000 |
| LogP | 0.90250 |
| Index of Refraction | 1.622 |
| InChIKey | FFZFOPJYTBRNAG-DHZHZOJOSA-N |
| SMILES | COc1ccc(C=C2CN(CCC(=O)O)C(=O)C2=O)cc1 |
|
~63%
3-[4-[(4-methox... CAS#:76628-84-7 |
| Literature: Madhav; Snyder; Southwick Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 6 p. 1231 - 1235 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |