2-(4-Chlorophenyl)ethanesulfonyl chloride structure
|
Common Name | 2-(4-Chlorophenyl)ethanesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 76653-13-9 | Molecular Weight | 239.11900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Chlorophenyl)ethanesulfonyl chloride |
|---|
| Molecular Formula | C8H8Cl2O2S |
|---|---|
| Molecular Weight | 239.11900 |
| Exact Mass | 237.96200 |
| PSA | 42.52000 |
| LogP | 3.53190 |
| InChIKey | RDLOYHZHKDCZHO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)CCc1ccc(Cl)cc1 |
|
~82%
2-(4-Chlorophen... CAS#:76653-13-9 |
| Literature: Abramovitch, Rudolph A.; Holcomb, William D.; Wake, Shigeo Journal of the American Chemical Society, 1981 , vol. 103, # 6 p. 1525 - 1533 |
|
~%
2-(4-Chlorophen... CAS#:76653-13-9 |
| Literature: Abramovitch, Rudolph A.; Holcomb, William D.; Wake, Shigeo Journal of the American Chemical Society, 1981 , vol. 103, # 6 p. 1525 - 1533 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |