(1|S|,2|S|)-|N|,|N|'-Dimethyl-|N|,|N|'-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine structure
|
Common Name | (1|S|,2|S|)-|N|,|N|'-Dimethyl-|N|,|N|'-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 767291-67-8 | Molecular Weight | 310.56100 | |
| Density | 0.87g/cm3 | Boiling Point | 345.8ºC at 760 mmHg | |
| Molecular Formula | C20H42N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.2ºC | |
| Name | (1S,2S)-N,N'-DiMethyl-N,N'-bis(3,3-diMethylbutyl)cyclohexane-1,2-diaMine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.87g/cm3 |
|---|---|
| Boiling Point | 345.8ºC at 760 mmHg |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.56100 |
| Flash Point | 143.2ºC |
| Exact Mass | 310.33500 |
| PSA | 6.48000 |
| LogP | 5.03360 |
| Index of Refraction | 1.479 |
| InChIKey | VGCWVKVNKNXOGZ-ROUUACIJSA-N |
| SMILES | CN(CCC(C)(C)C)C1CCCCC1N(C)CCC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921300090 |
| HS Code | 2921300090 |
|---|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (1S,2S)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine |