L-Arginine, L-aspartate structure
|
Common Name | L-Arginine, L-aspartate | ||
|---|---|---|---|---|
| CAS Number | 7675-83-4 | Molecular Weight | 307.304 | |
| Density | N/A | Boiling Point | 409.1ºC at 760 mmHg | |
| Molecular Formula | C10H21N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.2ºC | |
| Name | L-Arginine L-aspartate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 409.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H21N5O6 |
| Molecular Weight | 307.304 |
| Flash Point | 201.2ºC |
| Exact Mass | 307.149170 |
| PSA | 225.84000 |
| LogP | 0.12610 |
| Appearance of Characters | White |
| InChIKey | SUUWYOYAXFUOLX-ZBRNBAAYSA-N |
| SMILES | NC(CC(=O)O)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| Storage condition | ?20°C |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Tissue amino acid profile could be used to differentiate advanced adenoma from colorectal cancer.
J. Pharm. Biomed. Anal. 118 , 349-55, (2015) Advanced adenomas are of higher risk to progress to colorectal cancer (CRC), the third leading cause of cancerous death worldwide. Endoscopy-based adenoma removal greatly contributes to arresting the ... |
| MFCD00058334 |
| L-Aspartic acid, compd. with L-arginine (1:1) |
| L-Aspartic acid compd. with L-arginine (1:1) |
| L-Arginine - L-aspartic acid (1:1) |
| (2S)-2-aminobutanedioic acid,(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| L-Arginine, L-aspartate |
| L-Arginine, compd. with L-aspartic acid (1:1) |
| EINECS 231-656-8 |