N-ethyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-amine structure
|
Common Name | N-ethyl-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]nona-1,3,5,7-tetraen-7-amine | ||
|---|---|---|---|---|
| CAS Number | 7677-48-7 | Molecular Weight | 210.25300 | |
| Density | 1.4g/cm3 | Boiling Point | 378.7ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | N-ethyl-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 378.7ºC at 760 mmHg |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.25300 |
| Flash Point | 182.8ºC |
| Exact Mass | 210.04600 |
| PSA | 66.91000 |
| LogP | 1.65230 |
| Index of Refraction | 1.652 |
| InChIKey | PZZUBRHSSOQJRM-UHFFFAOYSA-N |
| SMILES | CCN=C1NS(=O)(=O)c2ccccc21 |
|
~78%
N-ethyl-9,9-dio... CAS#:7677-48-7 |
| Literature: Brigas, Amadeu F.; Clegg, William; Dillon, Christopher J.; Fonseca, Custodia F.C.; Johnstone, Robert A.W. Journal of the Chemical Society. Perkin Transactions 2, 2001 , # 8 p. 1315 - 1324 |
|
~75%
N-ethyl-9,9-dio... CAS#:7677-48-7 |
| Literature: Jensen, Klaus G.; Pedersen, Erik B. Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, 1981 , vol. 36, # 12 p. 1640 - 1643 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-Ethylamino-1,2-benzisothiazol-1,1-dioxid |