6-(4-methoxyphenyl)-4-oxo-pyran-2-carboxamide structure
|
Common Name | 6-(4-methoxyphenyl)-4-oxo-pyran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 76782-10-0 | Molecular Weight | 245.23100 | |
| Density | 1.338g/cm3 | Boiling Point | 541.2ºC at 760 mmHg | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.4ºC | |
| Name | 6-(4-methoxyphenyl)-4-oxopyran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 541.2ºC at 760 mmHg |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23100 |
| Flash Point | 312.4ºC |
| Exact Mass | 245.06900 |
| PSA | 82.53000 |
| LogP | 2.11460 |
| Index of Refraction | 1.606 |
| InChIKey | SGALSROPOKNSOG-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)cc(C(N)=O)o2)cc1 |
|
~93%
6-(4-methoxyphe... CAS#:76782-10-0 |
| Literature: Honma; Sekine; Hashiyama; Takeda; Ono; Tsuzurahara Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 12 p. 4314 - 4324 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-p-methoxyphenyl-4-pyrone-2-carboxamide |