1-(2-pyridylazo)-2-naphthol-6-sulfonic acid structure
|
Common Name | 1-(2-pyridylazo)-2-naphthol-6-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 76790-04-0 | Molecular Weight | 329.33100 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-6-oxo-5-(pyridin-2-ylhydrazinylidene)naphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.33100 |
| Exact Mass | 329.04700 |
| PSA | 117.10000 |
| LogP | 2.89420 |
| Index of Refraction | 1.706 |
| InChIKey | KVGXZCURLRLAGI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2c(N=Nc3ccccn3)c(O)ccc2c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pan-6S |