Ethyl 4-(4-chloro-1-oxobutyl)-alpha,alpha-dimethylbenzeneacetate structure
|
Common Name | Ethyl 4-(4-chloro-1-oxobutyl)-alpha,alpha-dimethylbenzeneacetate | ||
|---|---|---|---|---|
| CAS Number | 76811-97-7 | Molecular Weight | 296.78900 | |
| Density | 1.105 | Boiling Point | 409.8ºC at 760 mmHg | |
| Molecular Formula | C16H21ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | Ethyl 4-(4-chloro-1-oxobutyl)-α,α-dimethylbenzeneacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105 |
|---|---|
| Boiling Point | 409.8ºC at 760 mmHg |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.78900 |
| Flash Point | 150.7ºC |
| Exact Mass | 296.11800 |
| PSA | 43.37000 |
| LogP | 3.72900 |
| Index of Refraction | 1.506 |
| InChIKey | NQQITLVKOMJPDY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)c1ccc(C(=O)CCCCl)cc1 |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-[4-(4-Chloro-butyryl)-phenyl]-2-methyl-propionic acid |
| ETHYL,4-(4-CHLORO-1-OXOBUTYL)-A,A-DIMETHYLBENZENE ACETATE |
| Benzeneacetic acid,4-(4-chloro-1-oxobutyl)-a,a-diMethyl-,ethyl ester |
| 2-[4-(4-chloro-butyryl)-phenyl]-2-methyl-propionic acid,ethyl ester |
| MFCD07782109 |