Anisodine Hydromide
Anisodine Hydromide structure
|
Common Name | Anisodine Hydromide | ||
|---|---|---|---|---|
| CAS Number | 76822-34-9 | Molecular Weight | 400.264 | |
| Density | N/A | Boiling Point | 495ºC at 760 mmHg | |
| Molecular Formula | C17H22BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Anisodine hydrobromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 495ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H22BrNO5 |
| Molecular Weight | 400.264 |
| Flash Point | 253.2ºC |
| Exact Mass | 399.068115 |
| PSA | 82.53000 |
| LogP | 0.91810 |
| InChIKey | GJPDCORRBGIJOP-UHFFFAOYSA-N |
| SMILES | Br.CN1C2CC(OC(=O)C(O)(CO)c3ccccc3)CC1C1OC12 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 1544 |
| WGK Germany | 3 |
| RTECS | CY1633382 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| anisodinehydrobromide |
| Benzeneacetic acid, α-hydroxy-α-(hydroxymethyl)-, (1R,2S,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl ester, hydrobromide (1:1) |
| (1R,2S,4S,5S)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl 2,3-dihydroxy-2-phenylpropanoate hydrobromide (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Anisodine hydrobromide? |
| A: Molecular weight of Anisodine hydrobromide is 400.264. |
| Q: What is the boiling point of Anisodine hydrobromide? |
| A: Boiling point of Anisodine hydrobromide is 495ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of Anisodine hydrobromide? |
| A: Polar surface area (PSA) of Anisodine hydrobromide is 82.53000. |
| Q: What is the molecular formula of Anisodine hydrobromide? |
| A: Molecular formula of Anisodine hydrobromide is C17H22BrNO5. |
| Q: What English synonyms does Anisodine hydrobromide have? |
| A: English synonyms of Anisodine hydrobromide: anisodinehydrobromide, Benzeneacetic acid, α-hydroxy-α-(hydroxymethyl)-, (1R,2S,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl ester, hydrobromide (1:1), (1R,2S,4S,5S)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl 2,3-dihydroxy-2-phenylpropanoate hydrobromide (1:1). |
| Q: What is the InChIKey of Anisodine hydrobromide? |
| A: InChIKey of Anisodine hydrobromide is GJPDCORRBGIJOP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Anisodine hydrobromide? |
| A: SMILES notation of Anisodine hydrobromide is Br.CN1C2CC(OC(=O)C(O)(CO)c3ccccc3)CC1C1OC12. |
| Q: What is the English name of Anisodine hydrobromide? |
| A: The English name of Anisodine hydrobromide is Anisodine hydrobromide. |
| Q: What is the LogP of Anisodine hydrobromide? |
| A: LogP of Anisodine hydrobromide is 0.91810. |
| Q: What is the CAS number of Anisodine hydrobromide? |
| A: CAS number of Anisodine hydrobromide is 76822-34-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |