1-(1-adamantyl)-5-methyl-pyrimidine-2,4-dione structure
|
Common Name | 1-(1-adamantyl)-5-methyl-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 76849-32-6 | Molecular Weight | 260.33100 | |
| Density | 1.265g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-adamantyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33100 |
| Exact Mass | 260.15200 |
| PSA | 54.86000 |
| LogP | 1.77030 |
| Index of Refraction | 1.597 |
| InChIKey | RVCJPYOFOLUABM-UHFFFAOYSA-N |
| SMILES | Cc1cn(C23CC4CC(CC(C4)C2)C3)c(=O)[nH]c1=O |
|
~33%
1-(1-adamantyl)... CAS#:76849-32-6 |
| Literature: Saito,I.; Sugiyama,H.; Ito,S. Journal of the American Chemical Society, 1981 , vol. 103, p. 1598 |
|
~%
1-(1-adamantyl)... CAS#:76849-32-6 |
| Literature: Sasaki; Nakanishi; Ohno Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 6 p. 2051 - 2060 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-(1-adamantyl)thymine |