9H-Purin-6-amine,9-[3,5-O-(1-methylethylidene)-b-D-xylofuranosyl]- structure
|
Common Name | 9H-Purin-6-amine,9-[3,5-O-(1-methylethylidene)-b-D-xylofuranosyl]- | ||
|---|---|---|---|---|
| CAS Number | 7687-49-2 | Molecular Weight | 307.30500 | |
| Density | 1.8g/cm3 | Boiling Point | 588.3ºC at 760 mmHg | |
| Molecular Formula | C13H17N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.6ºC | |
| Name | 6-(6-aminopurin-9-yl)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
|---|
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 588.3ºC at 760 mmHg |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.30500 |
| Flash Point | 309.6ºC |
| Exact Mass | 307.12800 |
| PSA | 117.54000 |
| LogP | 0.39950 |
| Index of Refraction | 1.797 |
| InChIKey | XHZOUHXBGRSPRW-UHFFFAOYSA-N |
| SMILES | CC1(C)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O1 |
|
~52%
9H-Purin-6-amin... CAS#:7687-49-2 |
| Literature: Zemlicka; Bhuta Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 167 - 174 |
|
~%
9H-Purin-6-amin... CAS#:7687-49-2 |
| Literature: Baker; Hewson Journal of Organic Chemistry, 1957 , vol. 22, p. 959,965 |
|
~%
9H-Purin-6-amin... CAS#:7687-49-2 |
| Literature: Baker; Hewson Journal of Organic Chemistry, 1957 , vol. 22, p. 959,965 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |