9-pentofuranosyl-9H-purin-6-amine structure
|
Common Name | 9-pentofuranosyl-9H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 524-69-6 | Molecular Weight | 267.24 | |
| Density | 2.08g/cm3 | Boiling Point | 676.3ºC at 760 mmHg | |
| Molecular Formula | C10H13N5O4 | Melting Point | 257.0-257.5ºC (0.4 H2O) | |
| MSDS | N/A | Flash Point | 362.8ºC | |
Use of 9-pentofuranosyl-9H-purin-6-amine9-(β-D-Xylofuranosyl)adenine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 9-β-D-xylofuranosyladenine |
|---|---|
| Synonym | More Synonyms |
| Description | 9-(β-D-Xylofuranosyl)adenine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.08g/cm3 |
|---|---|
| Boiling Point | 676.3ºC at 760 mmHg |
| Melting Point | 257.0-257.5ºC (0.4 H2O) |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.24 |
| Flash Point | 362.8ºC |
| Exact Mass | 267.09700 |
| PSA | 139.54000 |
| Index of Refraction | 1.907 |
| InChIKey | OIRDTQYFTABQOQ-GAWUUDPSSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Adenine xyloside |
| Xylosyl a |
| Xylosyladenine |
| 9-.β.-D-Xylofuranosyladenine |
| 9-beta-D-xylofuranosyladenine |