5,5-dimethyl-3-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-one structure
|
Common Name | 5,5-dimethyl-3-(trifluoromethylsulfonyloxy)cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 76881-19-1 | Molecular Weight | 272.24100 | |
| Density | 1.42g/cm3 | Boiling Point | 291ºC at 760 mmHg | |
| Molecular Formula | C9H11F3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.8ºC | |
| Name | (5,5-dimethyl-3-oxocyclohexen-1-yl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 291ºC at 760 mmHg |
| Molecular Formula | C9H11F3O4S |
| Molecular Weight | 272.24100 |
| Flash Point | 129.8ºC |
| Exact Mass | 272.03300 |
| PSA | 68.82000 |
| LogP | 3.20640 |
| Index of Refraction | 1.459 |
| InChIKey | UINBCLOSQYROKH-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(OS(=O)(=O)C(F)(F)F)C1 |
|
~99%
5,5-dimethyl-3-... CAS#:76881-19-1 |
| Literature: Hoang, Tung T.; Dudley, Gregory B. Organic Letters, 2013 , vol. 15, # 15 p. 4026 - 4029 |
|
~75%
5,5-dimethyl-3-... CAS#:76881-19-1 |
| Literature: Scheiper, Bodo; Bonnekessel, Melanie; Krause, Helga; Fuerstner, Alois Journal of Organic Chemistry, 2004 , vol. 69, # 11 p. 3943 - 3949 |
| 5,5-dimethyl-3-triflyloxycyclohex-2-enone |
| 5,5-dimethyl-3-trifluoromethanesulfonyloxycyclohex-2-ene-1-one |
| 4,4-dimethyl-3-oxocyclohex-1-enyl trifluoromethanesulfonate |
| 5,5-dimethyl-3-trifluoromethylsulfonyloxycyclohex-2-en-1-one |
| 5,5-dimethyl-3-<<(trifluoromethyl)sulfonyl>oxy>cyclohex-2-enone |
| 5,5-dimethyl-3-oxocyclohex-1-en-1-yl trifluoromethanesulfonate |
| trifluoromethanesulfonic acid 5,5-dimethyl-3-oxocyclohex-1-enyl ester |