[4-(2,4,6-tripropan-2-ylbenzoyl)phenyl]-(2,4,6-tripropan-2-ylphenyl)methanone structure
|
Common Name | [4-(2,4,6-tripropan-2-ylbenzoyl)phenyl]-(2,4,6-tripropan-2-ylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 76893-85-1 | Molecular Weight | 538.80200 | |
| Density | 0.986g/cm3 | Boiling Point | 629.3ºC at 760 mmHg | |
| Molecular Formula | C38H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.1ºC | |
| Name | [4-[2,4,6-tri(propan-2-yl)benzoyl]phenyl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|
| Density | 0.986g/cm3 |
|---|---|
| Boiling Point | 629.3ºC at 760 mmHg |
| Molecular Formula | C38H50O2 |
| Molecular Weight | 538.80200 |
| Flash Point | 227.1ºC |
| Exact Mass | 538.38100 |
| PSA | 34.14000 |
| LogP | 10.88900 |
| Index of Refraction | 1.538 |
| InChIKey | BWIUGONJXLMFIC-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)c2ccc(C(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc2)c(C(C)C)c1 |
|
~51%
[4-(2,4,6-tripr... CAS#:76893-85-1 |
| Literature: Ito, Yoshikatsu; Giri, Brij Pal; Nakasuji, Masaaki; Hagiwara, Toshiya; Matsuura, Teruo Journal of the American Chemical Society, 1983 , vol. 105, # 5 p. 1117 - 1122 |
|
~%
[4-(2,4,6-tripr... CAS#:76893-85-1 |
| Literature: Ito, Yoshikatsu; Giri, Brij Pal; Nakasuji, Masaaki; Hagiwara, Toshiya; Matsuura, Teruo Journal of the American Chemical Society, 1983 , vol. 105, # 5 p. 1117 - 1122 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |