2-Chloro-6-nitroaniline structure
|
Common Name | 2-Chloro-6-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 769-11-9 | Molecular Weight | 172.569 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 284.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.8±21.8 °C | |
| Name | 2-Chloro-6-Nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±20.0 °C at 760 mmHg |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.569 |
| Flash Point | 125.8±21.8 °C |
| Exact Mass | 172.003952 |
| PSA | 71.84000 |
| LogP | 2.90 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | VOTXWUCYIOPNNR-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cccc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921420090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chloro-6-nitro aniline |
| Aniline, 2-chloro-6-nitro- |
| 6-chloro-2-nitroaniline |
| EINECS 212-204-9 |
| Benzenamine, 2-chloro-6-nitro- |
| 2-Chloro-6-nitroaniline |
| MFCD00179568 |