(5ξ)-13-Methylpodocarpa-8,11,13-triene-3,12-diol
Modify Date: 2025-09-10 19:23:51
(5ξ)-13-Methylpodocarpa-8,11,13-triene-3,12-diol structure
|
Common Name | (5ξ)-13-Methylpodocarpa-8,11,13-triene-3,12-diol | ||
|---|---|---|---|---|
| CAS Number | 769140-74-1 | Molecular Weight | 274.40 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 408.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4±23.3 °C | |
Use of (5ξ)-13-Methylpodocarpa-8,11,13-triene-3,12-diol13-Methyl-8,11,13-podocarpatriene-3,12-diol is a podocarpane-type diterpenoid isolated from Ricinodendron heudelotii[1]. |
| Name | 13-Methyl-8,11,13-podocarpatriene-3,12-diol |
|---|---|
| Synonym | More Synonyms |
| Description | 13-Methyl-8,11,13-podocarpatriene-3,12-diol is a podocarpane-type diterpenoid isolated from Ricinodendron heudelotii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.7±45.0 °C at 760 mmHg |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 |
| Flash Point | 186.4±23.3 °C |
| Exact Mass | 274.193268 |
| PSA | 40.46000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | ULORBDMEFAYHRJ-XYJFISCASA-N |
| SMILES | Cc1cc2c(cc1O)C1(C)CCC(O)C(C)(C)C1CC2 |
| Hazard Codes | Xi |
|---|
| 2,6-Phenanthrenediol, 1,2,3,4,4a,9,10,10a-octahydro-1,1,4a,7-tetramethyl-, (4aS)- |
| (5ξ)-13-Methylpodocarpa-8,11,13-triene-3,12-diol |