Imidazo[2,1-b]thiazole-5-methanol, 6-phenyl- structure
|
Common Name | Imidazo[2,1-b]thiazole-5-methanol, 6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 76919-41-0 | Molecular Weight | 230.28600 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N2OS | Melting Point | 198-200ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6-Phenylimidazo[2,1-b][1,3]thiazol-5-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Melting Point | 198-200ºC |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.28600 |
| Exact Mass | 230.05100 |
| PSA | 65.77000 |
| LogP | 2.55510 |
| Index of Refraction | 1.715 |
| InChIKey | AGNXXFZBPOCOPO-UHFFFAOYSA-N |
| SMILES | OCc1c(-c2ccccc2)nc2sccn12 |
| HS Code | 2934100090 |
|---|
|
~%
Imidazo[2,1-b]t... CAS#:76919-41-0 |
| Literature: Farmaco, Edizione Scientifica, , vol. 35, # 11 p. 896 - 901 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| phenylimidazobthiazolylmethanol |
| {6-phenylimidazo[2,1-b][1,3]thiazol-5-yl}methanol |
| 5-idrossimetil-6-fenilimidazo<2,1-b>tiazolo |