2,5-Pyrrolidinedione,1-[[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]oxy]-,hydrobromide (1:1) structure
|
Common Name | 2,5-Pyrrolidinedione,1-[[5-[(3aS,4S,6aR)-2-amino-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]oxy]-,hydrobromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 76939-67-8 | Molecular Weight | 340.39800 | |
| Density | 1.68g/cm3 | Boiling Point | 534.2ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 276.9ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | 2-iminobiotin n-hydroxysuccinimide ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 534.2ºC at 760 mmHg |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.39800 |
| Flash Point | 276.9ºC |
| Exact Mass | 340.12100 |
| PSA | 136.89000 |
| LogP | 0.82940 |
| Index of Refraction | 1.758 |
| InChIKey | AOQVRPXBTSXMRA-UYNHQEOZSA-N |
| SMILES | Br.NC1=NC2CSC(CCCCC(=O)ON3C(=O)CCC3=O)C2N1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H315-H319-H332-H335-H350 |
| Precautionary Statements | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R45 |
| Safety Phrases | 53-22-26-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
|
The use of the 2-iminobiotin-avidin interaction for the selective retrieval of labeled plasma membrane components.
J. Biol. Chem. 256 , 761, (1981) A general method for the selective retrieval of surface labeled plasma membrane components had been devised. The basis of the technique is the covalent attachment of compounds containing 2-iminobiotin... |
| 2-iminobiotin N-hydroxysuccinimide*ester hydrobro |
| 2-Iminobiotin NHS |
| N-Hydroxysuccinimido-2-iminobiotin |
| BIOTIN-NHS,2-IMINO |
| 2-IMINOBIOTIN,NHS ESTER |