Phosphinous acid,P,P-diphenyl-, 2,2,2-trifluoroethyl ester structure
|
Common Name | Phosphinous acid,P,P-diphenyl-, 2,2,2-trifluoroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 76943-19-6 | Molecular Weight | 284.21300 | |
| Density | N/A | Boiling Point | 305ºC at 760 mmHg | |
| Molecular Formula | C14H12F3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.3ºC | |
| Name | diphenyl(2,2,2-trifluoroethoxy)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 305ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H12F3OP |
| Molecular Weight | 284.21300 |
| Flash Point | 138.3ºC |
| Exact Mass | 284.05800 |
| PSA | 22.82000 |
| LogP | 3.61320 |
| InChIKey | PTHSAYLKDPDIEH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COP(c1ccccc1)c1ccccc1 |
|
~80%
Phosphinous aci... CAS#:76943-19-6 |
| Literature: Lowther, Nicholas; Beer, Paul D.; Hall, C. Dennis Phosphorus and Sulfur and the Related Elements, 1988 , vol. 35, p. 133 - 140 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,2,2-trifluoroethyl diphenylphosphinite |