Gibberellins structure
|
Common Name | Gibberellins | ||
|---|---|---|---|---|
| CAS Number | 77-06-5 | Molecular Weight | 346.374 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 628.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O6 | Melting Point | 227 °C | |
| MSDS | Chinese USA | Flash Point | 231.4±25.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of GibberellinsGibberellic Acid is named after a fungus Gibberella fujikuroi . Gibberellic Acid regulates processes of plant development and growth, including seed development and germination, stem and root growth, cell division, and flowering time[1]. |
| Name | gibberellin A3 |
|---|---|
| Synonym | More Synonyms |
| Description | Gibberellic Acid is named after a fungus Gibberella fujikuroi . Gibberellic Acid regulates processes of plant development and growth, including seed development and germination, stem and root growth, cell division, and flowering time[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.6±55.0 °C at 760 mmHg |
| Melting Point | 227 °C |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.374 |
| Flash Point | 231.4±25.0 °C |
| Exact Mass | 346.141632 |
| PSA | 104.06000 |
| LogP | 0.01 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | IXORZMNAPKEEDV-OBDJNFEBSA-N |
| SMILES | C=C1CC23CC1(O)CCC2C12C=CC(O)C(C)(C(=O)O1)C2C3C(=O)O |
| Stability | Stable. Combustible. Incompatible with acids, strong oxidizing agents. |
| Water Solubility | 5 G/L (20 º C) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | LY8990000 |
| Hazard Class | 5.2 |
| HS Code | 29322980 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 29322980 |
|---|
|
Cotton WRKY1 mediates the plant defense-to-development transition during infection of cotton by Verticillium dahliae by activating JASMONATE ZIM-DOMAIN1 expression.
Plant Physiol. 166(4) , 2179-94, (2014) Plants have evolved an elaborate signaling network to ensure an appropriate level of immune response to meet the differing demands of developmental processes. Previous research has demonstrated that D... |
|
|
Gibberellin Promotes Shoot Branching in the Perennial Woody Plant Jatropha curcas.
Plant Cell Physiol. 56 , 1655-66, (2015) Strigolactone (SL), auxin and cytokinin (CK) interact to regulate shoot branching. CK has long been considered to be the only key phytohormone to promote lateral bud outgrowth. Here we report that gib... |
|
|
SCARECROW-LIKE15 interacts with HISTONE DEACETYLASE19 and is essential for repressing the seed maturation programme.
Nat. Commun. 6 , 7243, (2015) Epigenetic regulation of gene expression is critical for controlling embryonic properties during the embryo-to-seedling phase transition. Here we report that a histone deacetylase19 (HDA19)-associated... |
| Ralex |
| Activol |
| (1R,2R,5S,8S,9S,10R,12S)-5,12-Dihydroxy-11-methyl-6-methylene-16-oxo-15-oxapentacyclo[9.3.2.1.0.0]heptadec-13-ene-9-carboxylic acid |
| Maxon |
| (3S,3aR,4S,4aS,7S,9aR,9bR,12S)-7,12-Dihydroxy-3-methyl-6-methylene-2-oxoperhydro-4a,7-methano-9b,3-propenoazuleno[1,2-b]furan-4-carboxylic acid |
| Gibbrel |
| (1S,2S,4aR,4bR,7S,9aS,10S,10aR)-2,7-dihydroxy-1-methyl-8-methylidene-13-oxo-1,2,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid |
| ryzup |
| (2S,4aR,4bR,7S,9aS,10S,10aR)-2,7-dihydroxy-1-methyl-8-methylidene-13-oxo-1,2,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid |
| Gibberellin X |
| Gibberelic acid |
| GIBREL |
| GA3 |
| GIBBEX |
| (1S,2S,4aR,4bR,7S,9aS,10S,10aR)-1,2,4b,5,6,7,8,9,10,10a-decahydro-2,7-dihydroxy-1-methyl-8-methylene-13-oxo-4a,1-(epoxymethano)-7,9a-methanobenz[a]azulene-10-carboxylic acid |
| Gibberellic acid GA3 |
| EINECS 201-001-0 |
| GIB |
| pgr-iv |
| Grocel |
| GIBERELLIN |
| Gibberellin A3 |
| MFCD00079329 |
| (3S,3aR,4S,4aS,6S,8aR,8bR,11S)-6,11-dihydroxy-3-methyl-12-methylene-2-oxo-4a,6-ethano-3,8b-prop-1-enoperhydroindeno[1,2-b]furan-4-carboxylic acid |
| (1a,2b,4aa,4bb,10b)-2,4a,7-Trihydroxy-1-methyl-8-methylenegibb-3-ene-1,10-dicarboxylic Acid 1,4a-Lactone |
| gibberellin |
| UVEX |
| (3S,3aS,4S,4aS,7S,9aR,9bR,12S)-7,12-dihydroxy-3-methyl-6-methylene-2-oxoperhydro-4a,7-methano-9b,3-propenoazuleno[1,2-b]furan-4-carboxylic acid |
| 4a,1-(Epoxymethano)-7,9a-methanobenz[a]azulene-10-carboxylic acid, 1,2,4b,5,6,7,8,9,10,10a-decahydro-2,7-dihydroxy-1-methyl-8-methylene-13-oxo-, (2S,4aR,4bR,7S,9aS,10S,10aR)- |
| Gibberellic acid |