5,5',6,6'-TETRAHYDROXY-3,3,3',3'-TETRAMETHYL-1,1'-SPIROBISINDANE structure
|
Common Name | 5,5',6,6'-TETRAHYDROXY-3,3,3',3'-TETRAMETHYL-1,1'-SPIROBISINDANE | ||
|---|---|---|---|---|
| CAS Number | 77-08-7 | Molecular Weight | 340.41300 | |
| Density | 1.37g/cm3 | Boiling Point | 561.2ºC at 760 mmHg | |
| Molecular Formula | C21H24O4 | Melting Point | 300ºC | |
| MSDS | Chinese USA | Flash Point | 260.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5,5',6,6'-Tetrahydroxy-3,3,3',3'-tetraMethyl-1,1'-spirobiindan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 561.2ºC at 760 mmHg |
| Melting Point | 300ºC |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.41300 |
| Flash Point | 260.8ºC |
| Exact Mass | 340.16700 |
| PSA | 80.92000 |
| LogP | 4.15770 |
| Index of Refraction | 1.694 |
| InChIKey | POFMQEVZKZVAPQ-UHFFFAOYSA-N |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(O)c(O)cc32)c2cc(O)c(O)cc21 |
| Water Solubility | Slightly soluble in methanol. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39-36 |
| RIDADR | NONH for all modes of transport |
|
~60%
5,5',6,6'-TETRA... CAS#:77-08-7 |
| Literature: Dei, Andrea; Sorace, Lorenzo Journal of the Chemical Society. Dalton Transactions, 2003 , # 17 p. 3382 - 3386 |
|
~%
5,5',6,6'-TETRA... CAS#:77-08-7 |
| Literature: Baker; Jukes; Subrahmanyam Journal of the Chemical Society, 1934 , p. 1681,1683 |
|
~%
5,5',6,6'-TETRA... CAS#:77-08-7 |
| Literature: Baker; Jukes; Subrahmanyam Journal of the Chemical Society, 1934 , p. 1681,1683 |
| 5,5',6,6'-tetrahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobisindane |
| EINECS 201-003-1 |
| MFCD00021235 |