2,2'-methylenebis[6-(1-methylcyclohexyl)-p-cresol]
Modify Date: 2026-07-17 11:54:28
![2,2'-methylenebis[6-(1-methylcyclohexyl)-p-cresol] Structure](https://image.chemsrc.com/caspic/363/77-62-3.png)
2,2'-methylenebis[6-(1-methylcyclohexyl)-p-cresol] structure
|
Common Name | 2,2'-methylenebis[6-(1-methylcyclohexyl)-p-cresol] | ||
|---|---|---|---|---|
| CAS Number | 77-62-3 | Molecular Weight | 420.62700 | |
| Density | 1.058g/cm3 | Boiling Point | 526.9ºC at 760 mmHg | |
| Molecular Formula | C29H40O2 | Melting Point | 135ºC | |
| MSDS | N/A | Flash Point | 219.2ºC | |
| Name | Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 526.9ºC at 760 mmHg |
| Melting Point | 135ºC |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.62700 |
| Flash Point | 219.2ºC |
| Exact Mass | 420.30300 |
| PSA | 40.46000 |
| LogP | 7.74900 |
| Index of Refraction | 1.567 |
| InChIKey | PHXLONCQBNATSL-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)cc(C3(C)CCCCC3)c2O)c(O)c(C2(C)CCCCC2)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| HS Code | 2907299090 |
|
~%
2,2'-methyleneb... CAS#:77-62-3 |
| Literature: US2762787 , ; |
|
~%
2,2'-methyleneb... CAS#:77-62-3 |
| Literature: US2762787 , ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
Total 1, Current Page 1 of 1
1
| MFCD00151797 |
| bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane |
| EINECS 201-044-5 |