4-(phenylsulfonyl)benzyl alcohol
4-(phenylsulfonyl)benzyl alcohol structure
|
Common Name | 4-(phenylsulfonyl)benzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 7705-64-8 | Molecular Weight | 248.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(phenylsulfonyl)benzyl alcohol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O3S |
|---|---|
| Molecular Weight | 248.29800 |
| Exact Mass | 248.05100 |
| PSA | 62.75000 |
| LogP | 3.09250 |
| InChIKey | CTJSJECQOXDNTO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(CO)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:7705-63-7![Propionitrile,2-[p-(phenylsulfonyl)benzyl]-2,3-bis[p-(phenylsulfonyl)phenyl]- (8CI) structure](https://image.chemsrc.com/caspic/031/7705-65-9.png)
CAS#:7705-65-9
CAS#:7718-66-3
CAS#:66-39-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Benzolsulfonyl-benzylalkohol |
| (4-benzenesulfonylphenyl)methanol |
| 4-Benzolsulfonyl-benzylalkohol |
| [4-(phenylsulfonyl)phenyl]methanol |
| (4-benzenesulfonyl-phenyl)-methanol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7705-64-8? |
| A: Chinese name of 7705-64-8 is 7705-64-8. |
| Q: What English synonyms does 4-(phenylsulfonyl)benzyl alcohol have? |
| A: English synonyms of 4-(phenylsulfonyl)benzyl alcohol: p-Benzolsulfonyl-benzylalkohol, (4-benzenesulfonylphenyl)methanol, 4-Benzolsulfonyl-benzylalkohol, [4-(phenylsulfonyl)phenyl]methanol, (4-benzenesulfonyl-phenyl)-methanol. |
| Q: What is the polar surface area (PSA) of 4-(phenylsulfonyl)benzyl alcohol? |
| A: Polar surface area (PSA) of 4-(phenylsulfonyl)benzyl alcohol is 62.75000. |
| Q: What is the CAS number of 4-(phenylsulfonyl)benzyl alcohol? |
| A: CAS number of 4-(phenylsulfonyl)benzyl alcohol is 7705-64-8. |
| Q: What is the InChIKey of 4-(phenylsulfonyl)benzyl alcohol? |
| A: InChIKey of 4-(phenylsulfonyl)benzyl alcohol is CTJSJECQOXDNTO-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-(phenylsulfonyl)benzyl alcohol? |
| A: LogP of 4-(phenylsulfonyl)benzyl alcohol is 3.09250. |
| Q: What is the SMILES notation of 4-(phenylsulfonyl)benzyl alcohol? |
| A: SMILES notation of 4-(phenylsulfonyl)benzyl alcohol is O=S(=O)(c1ccccc1)c1ccc(CO)cc1. |
| Q: What is the molecular formula of 4-(phenylsulfonyl)benzyl alcohol? |
| A: Molecular formula of 4-(phenylsulfonyl)benzyl alcohol is C13H12O3S. |
| Q: What are the downstream products of 4-(phenylsulfonyl)benzyl alcohol? |
| A: Related downstream products(CAS) of 4-(phenylsulfonyl)benzyl alcohol: 7705-63-7;7705-65-9;7718-66-3;66-39-7. |
| Q: What is the molecular weight of 4-(phenylsulfonyl)benzyl alcohol? |
| A: Molecular weight of 4-(phenylsulfonyl)benzyl alcohol is 248.29800. |