1-(benzenesulfonyl)-4-(bromomethyl)benzene structure
|
Common Name | 1-(benzenesulfonyl)-4-(bromomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 7705-63-7 | Molecular Weight | 311.19400 | |
| Density | 1.501g/cm3 | Boiling Point | 442.6ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 1-(benzenesulfonyl)-4-(bromomethyl)benzene |
|---|
| Density | 1.501g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760 mmHg |
| Molecular Formula | C13H11BrO2S |
| Molecular Weight | 311.19400 |
| Flash Point | 221.5ºC |
| Exact Mass | 309.96600 |
| PSA | 42.52000 |
| LogP | 4.49510 |
| Index of Refraction | 1.618 |
| InChIKey | HBKDLRFVBAEDCF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(CBr)cc1 |
|
~82%
1-(benzenesulfo... CAS#:7705-63-7 |
| Literature: Beers, Scott A. Patent: US2006/293374 A1, 2006 ; Location in patent: Page/Page column 25 ; |
|
~%
1-(benzenesulfo... CAS#:7705-63-7 |
| Literature: Lotspeich,F.J. Journal of Organic Chemistry, 1967 , vol. 32, p. 1274 - 1277 |
|
~%
1-(benzenesulfo... CAS#:7705-63-7 |
| Literature: Lotspeich,F.J. Journal of Organic Chemistry, 1967 , vol. 32, p. 1274 - 1277 |