2,5-diphenylthiazol-4-amine structure
|
Common Name | 2,5-diphenylthiazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 77077-60-2 | Molecular Weight | 252.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-diphenyl-1,3-thiazol-4-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2S |
|---|---|
| Molecular Weight | 252.33400 |
| Exact Mass | 252.07200 |
| PSA | 67.15000 |
| LogP | 4.64050 |
| InChIKey | LTACVNCFAZYWSP-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)sc1-c1ccccc1 |
|
~%
2,5-diphenylthi... CAS#:77077-60-2 |
| Literature: Taylor et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: The compound was tested for the in vitro inhibition of 5-lipoxygenase (5-lo) from the...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL619429
|
| 4-Thiazolamine,2,5-diphenyl |
| 2,5-diphenylthiazol-4-amine |
| 2,5-diphenyl-thiazol-4-ylamine |
| diphenyl-1,3-thiazol-4-amine |