bis(2-hydroxyethyl) piperazine-1,4-dicarboxylate structure
|
Common Name | bis(2-hydroxyethyl) piperazine-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 7709-79-7 | Molecular Weight | 262.26000 | |
| Density | 1.367g/cm3 | Boiling Point | 439ºC at 760 mmHg | |
| Molecular Formula | C10H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3ºC | |
| Name | bis(2-hydroxyethyl) piperazine-1,4-dicarboxylate |
|---|
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760 mmHg |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26000 |
| Flash Point | 219.3ºC |
| Exact Mass | 262.11600 |
| PSA | 99.54000 |
| Index of Refraction | 1.536 |
| InChIKey | HZZUEGCSOFFDFJ-UHFFFAOYSA-N |
| SMILES | O=C(OCCO)N1CCN(C(=O)OCCO)CC1 |
|
~%
bis(2-hydroxyet... CAS#:7709-79-7 |
| Literature: Viard; Piganiol Chim. et Ind. Sonderband 23. Congr. Chim. ind. Mailand, 1950 , p. 233,235 Show Details Dyer; Scott Journal of the American Chemical Society, 1957 , vol. 79, p. 672,674 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |