Methyl 4-hydroxy-1H-indole-6-carboxylate structure
|
Common Name | Methyl 4-hydroxy-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 77140-48-8 | Molecular Weight | 191.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 435.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | 148-149°C | |
| MSDS | N/A | Flash Point | 217.2±23.2 °C | |
| Name | Methyl 4-hydroxy-1H-indole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.5±25.0 °C at 760 mmHg |
| Melting Point | 148-149°C |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.183 |
| Flash Point | 217.2±23.2 °C |
| Exact Mass | 191.058243 |
| PSA | 62.32000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | YCLHTEHHXRJHKC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c2cc[nH]c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
Methyl 4-hydrox... CAS#:77140-48-8 |
| Literature: Kim, Musong; Vedejs, Edwin Journal of Organic Chemistry, 2004 , vol. 69, # 20 p. 6945 - 6948 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-6-carboxylic acid, 4-hydroxy-, methyl ester |
| Methyl 4-hydroxy-1H-indole-6-carboxylate |