ethyl 2-bromo-2-(4-bromophenyl)acetate structure
|
Common Name | ethyl 2-bromo-2-(4-bromophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 77143-76-1 | Molecular Weight | 321.99300 | |
| Density | 1.642 | Boiling Point | 140ºC5 mm Hg(lit.) | |
| Molecular Formula | C10H10Br2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | ethyl 2-bromo-2-(4-bromophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642 |
|---|---|
| Boiling Point | 140ºC5 mm Hg(lit.) |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 321.99300 |
| Flash Point | >230 °F |
| Exact Mass | 319.90500 |
| PSA | 26.30000 |
| LogP | 3.44820 |
| Index of Refraction | n20/D 1.5710(lit.) |
| InChIKey | PPRAWWBOUOBAON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)c1ccc(Br)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive;N: Dangerous for the environment; |
| Risk Phrases | 34-51/53 |
| Safety Phrases | 26-36/37/39-61 |
| RIDADR | UN 3265 8/PG 2 |
| Packaging Group | II |
| HS Code | 2916399090 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD06411309 |
| Ethyl 2-bromo-(4-bromophenyl)acetate |
| 2-bromo-(4-bromo-phenyl)-acetic acid ethyl ester |
| 2-Brom-2-(4-brom-phenyl)-essigsaeure-aethylester |
| ethyl bromo-(4-bromophenyl)acetate |