2-amino-1-[4-(trifluoromethyl)phenyl]ethanone structure
|
Common Name | 2-amino-1-[4-(trifluoromethyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 771582-55-9 | Molecular Weight | 203.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-1-[4-(trifluoromethyl)phenyl]ethanone |
|---|
| Molecular Formula | C9H8F3NO |
|---|---|
| Molecular Weight | 203.16100 |
| Exact Mass | 203.05600 |
| PSA | 43.09000 |
| LogP | 2.54710 |
| InChIKey | IPAYFXBCHAVJHO-UHFFFAOYSA-N |
| SMILES | NCC(=O)c1ccc(C(F)(F)F)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |