L 640035
L 640035 structure
|
Common Name | L 640035 | ||
|---|---|---|---|---|
| CAS Number | 77167-93-2 | Molecular Weight | 272.31900 | |
| Density | 1.378g/cm3 | Boiling Point | 516.5ºC at 760 mmHg | |
| Molecular Formula | C15H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
Use of L 640035L 640035 is athromboxaneantagonist[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | L 640035 is athromboxaneantagonist[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760 mmHg |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.31900 |
| Flash Point | 266.2ºC |
| Exact Mass | 272.05100 |
| PSA | 62.75000 |
| LogP | 3.57630 |
| Index of Refraction | 1.667 |
| InChIKey | NYFDVYBQHBRTNS-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2ccccc2C=Cc2ccc(CO)cc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
![11,11-dioxobenzo[b][1]benzothiepine-2-carboxylic acid Structure](https://image.chemsrc.com/caspic/380/71474-64-1.png)
CAS#:71474-64-1![3-(hydroxymethyl)dibenzo[b,f]thiepin Structure](https://image.chemsrc.com/caspic/042/77167-91-0.png)
CAS#:77167-91-0
CAS#:2458-12-0
CAS#:7697-26-9
CAS#:82998-57-0
CAS#:101362-98-5
CAS#:109239-22-7
CAS#:109239-25-0![dibenzo[b,f]thiepin-3-carboxylic acid Structure](https://image.chemsrc.com/caspic/042/71474-60-7.png)
CAS#:71474-60-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: CAS number of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is 77167-93-2. |
| Q: What is the molecular formula of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: Molecular formula of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is C15H12O3S. |
| Q: What is the LogP of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: LogP of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is 3.57630. |
| Q: What is the molecular weight of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: Molecular weight of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is 272.31900. |
| Q: What is the boiling point of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: Boiling point of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is 516.5ºC at 760 mmHg. |
| Q: What is the Chinese name of 77167-93-2? |
| A: Chinese name of 77167-93-2 is 77167-93-2. |
| Q: What is the SMILES notation of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: SMILES notation of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is O=S1(=O)c2ccccc2C=Cc2ccc(CO)cc21. |
| Q: What are the uses of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: Main uses of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol: L 640035 is athromboxaneantagonist[1]. |
| Q: What is the English name of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: The English name of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol. |
| Q: What is the polar surface area (PSA) of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol? |
| A: Polar surface area (PSA) of (11,11-dioxobenzo[b][1]benzothiepin-2-yl)methanol is 62.75000. |