1,2-dimethyl-4-(4-methylphenoxy)benzene structure
|
Common Name | 1,2-dimethyl-4-(4-methylphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 7717-71-7 | Molecular Weight | 212.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-dimethyl-4-(4-methylphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O |
|---|---|
| Molecular Weight | 212.28700 |
| Exact Mass | 212.12000 |
| PSA | 9.23000 |
| LogP | 4.40410 |
| InChIKey | MITOOYSZNBJNHQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(C)c(C)c2)cc1 |
|
~89%
1,2-dimethyl-4-... CAS#:7717-71-7 |
| Literature: Marcoux; Doye; Buchwald Journal of the American Chemical Society, 1997 , vol. 119, # 43 p. 10539 - 10540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4,4'-trimethyldiphenyl ether |
| 3.4.4'-Trimethyl-phenyl-ether |