4-(3,4-dicarboxyphenoxy)benzene-1,2-dicarboxylic acid
4-(3,4-dicarboxyphenoxy)benzene-1,2-dicarboxylic acid structure
|
Common Name | 4-(3,4-dicarboxyphenoxy)benzene-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7717-76-2 | Molecular Weight | 346.24500 | |
| Density | 1.647g/cm3 | Boiling Point | 645.2ºC at 760 mmHg | |
| Molecular Formula | C16H10O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3,4-dicarboxyphenoxy)phthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 645.2ºC at 760 mmHg |
| Molecular Formula | C16H10O9 |
| Molecular Weight | 346.24500 |
| Flash Point | 242.1ºC |
| Exact Mass | 346.03200 |
| PSA | 158.43000 |
| LogP | 2.27170 |
| Index of Refraction | 1.691 |
| InChIKey | AIVVXPSKEVWKMY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
4-(3,4-dicarbox... CAS#:7717-76-2 |
| Literature: General Electric Company Patent: US2007/117990 A1, 2007 ; Location in patent: Page/Page column 13 ; |
|
~%
4-(3,4-dicarbox... CAS#:7717-76-2 |
| Literature: SABIC INNOVATIVE PLASTICS IP B.V. Patent: WO2009/120212 A1, 2009 ; Location in patent: Page/Page column 39-40 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-oxydiphthalic anhydride |
| 1,2-Benzenedicarboxylic acid,4,4'-oxybis |
| 3,3',4,4'-oxydiphthalic acid |
| 4,4'-axydiphthalic acid |
| 2,2',3,3'-oxydiphthalic acid |
| 4,4'-oxydiphthalic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: Molecular formula of 4-(3,4-dicarboxyphenoxy)phthalic acid is C16H10O9. |
| Q: What is the English name of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: The English name of 4-(3,4-dicarboxyphenoxy)phthalic acid is 4-(3,4-dicarboxyphenoxy)phthalic acid. |
| Q: What English synonyms does 4-(3,4-dicarboxyphenoxy)phthalic acid have? |
| A: English synonyms of 4-(3,4-dicarboxyphenoxy)phthalic acid: 4,4'-oxydiphthalic anhydride, 1,2-Benzenedicarboxylic acid,4,4'-oxybis, 3,3',4,4'-oxydiphthalic acid, 4,4'-axydiphthalic acid, 2,2',3,3'-oxydiphthalic acid, 4,4'-oxydiphthalic acid. |
| Q: What is the CAS number of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: CAS number of 4-(3,4-dicarboxyphenoxy)phthalic acid is 7717-76-2. |
| Q: What is the SMILES notation of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: SMILES notation of 4-(3,4-dicarboxyphenoxy)phthalic acid is O=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O. |
| Q: What is the LogP of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: LogP of 4-(3,4-dicarboxyphenoxy)phthalic acid is 2.27170. |
| Q: What is the molecular weight of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: Molecular weight of 4-(3,4-dicarboxyphenoxy)phthalic acid is 346.24500. |
| Q: What is the boiling point of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: Boiling point of 4-(3,4-dicarboxyphenoxy)phthalic acid is 645.2ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: Polar surface area (PSA) of 4-(3,4-dicarboxyphenoxy)phthalic acid is 158.43000. |
| Q: What are the downstream products of 4-(3,4-dicarboxyphenoxy)phthalic acid? |
| A: Related downstream products(CAS) of 4-(3,4-dicarboxyphenoxy)phthalic acid: 1823-59-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |