(S)-tert-butyl3-amino-2-(((benzyloxy)carbonyl)amino)propanoate structure
|
Common Name | (S)-tert-butyl3-amino-2-(((benzyloxy)carbonyl)amino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 77215-55-5 | Molecular Weight | 294.34600 | |
| Density | 1.142g/cm3 | Boiling Point | 444.312ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.512ºC | |
| Name | tert-butyl (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 444.312ºC at 760 mmHg |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.34600 |
| Flash Point | 222.512ºC |
| Exact Mass | 294.15800 |
| PSA | 90.65000 |
| LogP | 2.67300 |
| Index of Refraction | 1.524 |
| InChIKey | GUTOOFAUODQZRP-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)C(CN)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~72%
(S)-tert-butyl3... CAS#:77215-55-5 |
| Literature: DuPont Pharmaceuticals Company Patent: US6153628 A1, 2000 ; |
|
~%
(S)-tert-butyl3... CAS#:77215-55-5 |
| Literature: Polish Journal of Chemistry, , vol. 79, # 3 p. 567 - 572 |
|
~%
(S)-tert-butyl3... CAS#:77215-55-5
Detail
Learn More
|
| Literature: Journal of Medicinal Chemistry, , vol. 24, # 5 p. 554 - 559 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl (2S)-3-amino-2-{[(benzyloxy)carbonyl]amino}propanoate |
| tert-butyl-(2S)-2-benzyloxycarbonylamino-3-aminopropionate |
| tert-butyl (S)-3-amino-2-benzyloxycarbonylaminopropionate |
| (2S)-3-amino-2-benzyloxycarbonylamino-propionic acid tert-butyl ester |
| (s)-3-amino-2-cbz-amino-propionic acid tert-butyl ester |
| 2S-(benzyloxycarbonylamino)-3-aminopropionic acid tert-butylester |
| TERT-BUTYL (2S)-3-AMINO-2-BENZYLOXYCARBONYLAMINOPROPIONATE |
| A9778 |
| 3-amino-2-S-benzyloxycarbonyl-aminopropionic acid tert-butyl ester |
| (S)-tert-butyl 3-amino-2-(benzyloxycarbonyl)propanoate |
| tert-butyl N2-benzyloxycarbonyl-2(S)-2,3-diaminopropionate |