Cbz-beta-Amino-L-alanine structure
|
Common Name | Cbz-beta-Amino-L-alanine | ||
|---|---|---|---|---|
| CAS Number | 35761-26-3 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 463.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | 240ºC (dec.) | |
| MSDS | USA | Flash Point | 234.3±28.7 °C | |
Use of Cbz-beta-Amino-L-alanineN-Carbobenzyloxy--amino-L-alanine is an alanine derivative[1]. |
| Name | (S)-3-Amino-2-(benzyloxycarbonylamino)-propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Carbobenzyloxy--amino-L-alanine is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.8±45.0 °C at 760 mmHg |
| Melting Point | 240ºC (dec.) |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 234.3±28.7 °C |
| Exact Mass | 238.095352 |
| PSA | 101.65000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | FOXRXVSTFGNURG-VIFPVBQESA-N |
| SMILES | NCC(NC(=O)OCc1ccccc1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Chemistry and inhibitory activity of long chain fatty acid oxidation of emeriamine and its analogues.
J. Med. Chem. 30 , 1458, (1987) Emericedins A, B, and C, new betaines having inhibitory activity of long chain fatty acid oxidation, were isolated from the culture broth of Emericella quadrilineata IFO 5859. Their structures were de... |
|
|
Y. Funabashi et al.
Tetrahedron 49 , 13, (1993)
|
|
|
C. Mendre et al.
Tetrahedron Lett. 35 , 5429, (1994)
|
| (S)-3-Amino-2-(((benzyloxy)carbonyl)amino)propanoic acid |
| CBZ-L-B-AMINOALANINE |
| Z-L-DAP-OH |
| CBZ-L--Aminoalanine |
| H-DAP(Z)-OH |
| 3-Amino-N-(carbobenzoxy)-L-alanine |
| (2S)-3-amino-2-benzyloxycarbonylaminopropionic acid |
| (S)-N2-benzyloxycarbonyl-2,3-diaminopropionic acid |
| (S)-3-Amino-2-N-Cbz-propanoic acid |
| Cbz- L-2,3-diaminopropionic acid |
| (S)-Nα-Cbz-2,3-diaminopropionic Acid |
| Nα-Z-L-2,3-Diaminopropionic acid |
| Z-DAP-OH |
| (S)-3-Amino-2-(carbobenzoxyamino)propionic Acid |
| Cbz-Dap-OH |
| MFCD00237345 |
| CBZ-L-DAP-OH |
| 3-Amino-N-[(benzyloxy)carbonyl]alanine |
| Z-DPR-OH |
| (2S)-3-Amino-2-benzyloxycarbonylaminopropanoic acid |
| (S)-3-amino-2-benzyloxycarbonylaminopropionic acid |
| 2-(S)-<N-<(benzyloxy)carbonyl>amino>-3-aminopropionic acid |
| 3-Amino-N-Cbz-L-alanine |
| Alanine, 3-amino-N-[(phenylmethoxy)carbonyl]- |
| Cbz-L-2,3-diaminopropionic acid |
| 3-AMINO-2-N-CBZ-L-ALANINE |
| Cbz-beta-Amino-L-alanine |