potassium persulfate structure
|
Common Name | potassium persulfate | ||
|---|---|---|---|---|
| CAS Number | 7727-21-1 | Molecular Weight | 270.322 | |
| Density | 2.47 | Boiling Point | 1689 °C | |
| Molecular Formula | K2O8S2 | Melting Point | 1067 °C | |
| MSDS | Chinese USA | Flash Point | NotºCombustible | |
| Symbol |
GHS03, GHS07, GHS08 |
Signal Word | Danger | |
| Name | Potassium persulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.47 |
|---|---|
| Boiling Point | 1689 °C |
| Melting Point | 1067 °C |
| Molecular Formula | K2O8S2 |
| Molecular Weight | 270.322 |
| Flash Point | NotºCombustible |
| Exact Mass | 269.830872 |
| PSA | 149.62000 |
| LogP | 0.01660 |
| Vapour density | 9.3 (vs air) |
| InChIKey | USHAGKDGDHPEEY-UHFFFAOYSA-L |
| SMILES | O=S(=O)([O-])OOS(=O)(=O)[O-].[K+].[K+] |
| Stability | Stable. Strong oxidizer. Incompatible with strong reducing agents, organic materials, combustible materials. |
| Water Solubility | 5 g/100 mL (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS03, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H272-H302-H315-H317-H319-H334-H335 |
| Precautionary Statements | P220-P261-P280-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R36/37/38;R42/43;R8 |
| Safety Phrases | S22-S24-S26-S37 |
| RIDADR | UN 1492 5.1/PG 3 |
| WGK Germany | 1 |
| RTECS | TT5900000 |
| Packaging Group | III |
| Hazard Class | 5.1 |
| HS Code | 2833400000 |
| HS Code | 2833400000 |
|---|
|
Polymer hydrogel functionalized with biodegradable nanoparticles as composite system for controlled drug delivery.
Nanotechnology 26(1) , 015602, (2015) The possibility to direct pharmacological treatments targeting specific cell lines using polymer nanoparticles is one of the main novelties and perspectives in nanomedicine. However, sometimes, the ab... |
|
|
Antimicrobial Properties of Graphene Oxide Nanosheets: Why Size Matters.
ACS Nano 9 , 7226-36, (2015) Graphene oxide (GO) is a promising material for the development of antimicrobial surfaces due to its contact-based antimicrobial activity. However, the relationship between GO physicochemical properti... |
|
|
Nanocomposites with functionalised polysaccharide nanocrystals through aqueous free radical polymerisation promoted by ozonolysis.
Carbohydr. Polym. 135 , 256-66, (2015) Cellulose nanocrystals (CNC) and starch nanocrystals (SNC) were grafted by ozone-initiated free-radical polymerisation of styrene in a heterogeneous medium. Surface functionalisation was confirmed by ... |
| MFCD03457781 |
| EINECS 231-781-8 |
| dipotassium,sulfonatooxy sulfate |