ammonium persulfate structure
|
Common Name | ammonium persulfate | ||
|---|---|---|---|---|
| CAS Number | 7727-54-0 | Molecular Weight | 228.202 | |
| Density | 1.98 | Boiling Point | N/A | |
| Molecular Formula | H8N2O8S2 | Melting Point | 120 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS03, GHS07, GHS08 |
Signal Word | Danger | |
| Name | Ammonium persulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.98 |
|---|---|
| Melting Point | 120 °C |
| Molecular Formula | H8N2O8S2 |
| Molecular Weight | 228.202 |
| Exact Mass | 227.972198 |
| PSA | 150.44000 |
| LogP | 1.34960 |
| Vapour density | 7.9 (vs air) |
| Index of Refraction | 1.50 |
| InChIKey | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])OOS(=O)(=O)[O-].[NH4+].[NH4+] |
| Stability | Stable. Oxidizing. May ignite combustible material. Incompatible with bases, combustible material, hydrogen peroxide, peroxy compounds, silver compounds, zinc. May decompose upon exposure to water or moist air. |
| Water Solubility | 582 g/L (20 ºC) decomposes |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS03, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H272-H302-H315-H317-H319-H334-H335 |
| Precautionary Statements | P220-P261-P280-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R36/37/38;R42/43;R8 |
| Safety Phrases | S22-S24-S26-S37 |
| RIDADR | UN 1444 5.1/PG 3 |
| WGK Germany | 1 |
| RTECS | SE0350000 |
| Packaging Group | III |
| Hazard Class | 5.1 |
| HS Code | 2833400000 |
| HS Code | 2833400000 |
|---|
|
Aptamer-based polyvalent ligands for regulated cell attachment on the hydrogel surface.
Biomacromolecules 16(4) , 1382-9, (2015) Natural biomolecules are often used to functionalize materials to achieve desired cell-material interactions. However, their applications can be limited owing to denaturation during the material funct... |
|
|
Polymerization of affinity ligands on a surface for enhanced ligand display and cell binding.
Biomacromolecules 15(12) , 4561-9, (2014) Surfaces functionalized with affinity ligands have been widely studied for applications such as biological separations and cell regulation. While individual ligands can be directly conjugated onto a s... |
|
|
Use of an enzyme-assisted method to improve protein extraction from olive leaves.
Food Chem. 169 , 28-33, (2014) The improvement of protein extraction from olive leaves using an enzyme-assisted protocol has been investigated. Using a cellulase enzyme (Celluclast® 1.5L), different parameters that affect the extra... |
| Diammonium [(sulfonatoperoxy)sulfonyl]oxidanide |
| EINECS 231-786-5 |
| Diammonium persulphate |
| diazanium,sulfonatooxy sulfate |
| Diammonium peroxydisulphate |
| Diammonium peroxodisulfate |
| MFCD00003390 |
| ammonium peroxydisulphate |
| Diammonium peroxydisulfate |
| Ammonium peroxydisulfate |
| ammonium peroxodisulfate |
| ammonium persulphate |
| DIAMMONIUM PERSULFATE |