Zederone structure
|
Common Name | Zederone | ||
|---|---|---|---|---|
| CAS Number | 7727-79-9 | Molecular Weight | 246.302 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 365.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | 153.4-153.9℃ (acetone hexane ) | |
| MSDS | N/A | Flash Point | 174.7±27.9 °C | |
Use of ZederoneZederone, a germacrane-type sesquiterpene, has potently cytotoxic against human white blood cancer cells and human prostate cancer cells. Zederone significantly inhibits the proliferation and downregulates the protein expressions of mTOR, and phosphorylated p70 S6 kinase (p-p70s6K) in SKOV3 cells[1][2]. |
| Name | Zederone |
|---|---|
| Synonym | More Synonyms |
| Description | Zederone, a germacrane-type sesquiterpene, has potently cytotoxic against human white blood cancer cells and human prostate cancer cells. Zederone significantly inhibits the proliferation and downregulates the protein expressions of mTOR, and phosphorylated p70 S6 kinase (p-p70s6K) in SKOV3 cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
mTOR |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.3±42.0 °C at 760 mmHg |
| Melting Point | 153.4-153.9℃ (acetone hexane ) |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.302 |
| Flash Point | 174.7±27.9 °C |
| Exact Mass | 246.125595 |
| PSA | 42.74000 |
| LogP | 3.58 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | CVIVANCKIBYAOP-UHFFFAOYSA-N |
| SMILES | CC1=CCCC2(C)OC2C(=O)c2c(C)coc2C1 |
| Hazard Codes | Xi |
|---|
| 1a,5,9-Trimethyl-1a,3,6,10a-tetrahydrooxireno[4,5]cyclodeca[1,2-b]furan-10(2H)-one |