N,N'-dihydroxy-N,N'-diphenylpropanediamide structure
|
Common Name | N,N'-dihydroxy-N,N'-diphenylpropanediamide | ||
|---|---|---|---|---|
| CAS Number | 77280-27-4 | Molecular Weight | 286.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-dihydroxy-N,N'-diphenylpropanediamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O4 |
|---|---|
| Molecular Weight | 286.28300 |
| Exact Mass | 286.09500 |
| PSA | 81.08000 |
| LogP | 2.22130 |
| InChIKey | NCOOEFLFEJDWDV-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)N(O)c1ccccc1)N(O)c1ccccc1 |
|
~%
N,N'-dihydroxy-... CAS#:77280-27-4 |
| Literature: Hurd; Pilgrim Journal of the American Chemical Society, 1933 , vol. 55, p. 758 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Diphenyl-malonohydroxamsaeure |
| Propanediamide,N,N'-dihydroxy-N,N'-diphenyl |
| N,N'-dihydroxy-N,N'-diphenyl-malonamide |
| N,N'-Dihydroxy-malonanilid |