Ethyl 4-(4-methyl-1-piperazinyl)benzoate structure
|
Common Name | Ethyl 4-(4-methyl-1-piperazinyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 773137-71-6 | Molecular Weight | 248.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 376.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2±26.5 °C | |
| Name | ethyl 4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.0±37.0 °C at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.321 |
| Flash Point | 181.2±26.5 °C |
| Exact Mass | 248.152481 |
| PSA | 32.78000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | VKWDRYXONDYIGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N2CCN(C)CC2)cc1 |
| HS Code | 2933599090 |
|---|
|
~44%
Ethyl 4-(4-meth... CAS#:773137-71-6 |
| Literature: GENENTECH,INC.; FORMA TM, LLC; YUEN, Po-Wai; BAIR, Kenneth, W.; BAUMEISTER, Timm, R.; DRAGOVICH, Peter; LIU, Xiongcai; PATEL, Snahel; ZAK, Mark; ZHAO, Guiling; ZHANG, Yamin; ZHENG, Xiaozhang Patent: WO2013/127269 A1, 2013 ; Location in patent: Page/Page column 178 ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-Methylpiperazin-1-yl)benzoicacid ethyl ester |
| Ethyl 4-(4-methyl-1-piperazinyl)benzoate |
| Ethyl 4-(4-methylpiperazin-1-yl)benzoate |
| 4-(4-methyl-1-piperazinyl)benzoic acid ethyl ester |
| Benzoic acid, 4-(4-methyl-1-piperazinyl)-, ethyl ester |