2-methyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione structure
|
Common Name | 2-methyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 7741-81-3 | Molecular Weight | 181.18900 | |
| Density | 1.346g/cm3 | Boiling Point | 348.5ºC at 760 mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.6ºC | |
| Name | 2-methyl-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione |
|---|
| Density | 1.346g/cm3 |
|---|---|
| Boiling Point | 348.5ºC at 760 mmHg |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 164.6ºC |
| Exact Mass | 181.07400 |
| PSA | 46.61000 |
| Index of Refraction | 1.554 |
| InChIKey | QSASUQOUORMUIV-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2C3CCC(O3)C2C1=O |
|
~%
2-methyl-3a,4,5... CAS#:7741-81-3 |
| Literature: Maruyama, Kazuhiro; Ishitoku, Takeshi; Kubo, Yasuo Journal of Organic Chemistry, 1981 , vol. 46, # 1 p. 27 - 34 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |