3a-ethyl-2-methyl-3,5,10,10a-tetrahydro-2H-furo[2,3-b][1,5]benzodiazepin-4-one structure
|
Common Name | 3a-ethyl-2-methyl-3,5,10,10a-tetrahydro-2H-furo[2,3-b][1,5]benzodiazepin-4-one | ||
|---|---|---|---|---|
| CAS Number | 77414-12-1 | Molecular Weight | 246.30500 | |
| Density | 1.118g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 3a-ethyl-2-methyl-3,5,10,10a-tetrahydro-2H-furo[2,3-b][1,5]benzodiazepin-4-one |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 216.7ºC |
| Exact Mass | 246.13700 |
| PSA | 53.85000 |
| LogP | 2.80500 |
| Index of Refraction | 1.53 |
| InChIKey | RHARBRDZQQOHTC-UHFFFAOYSA-N |
| SMILES | CCC12CC(C)OC1Nc1ccccc1NC2=O |
|
~79%
3a-ethyl-2-meth... CAS#:77414-12-1 |
| Literature: Wagner, Edwin Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 131 - 139 |
|
~%
3a-ethyl-2-meth... CAS#:77414-12-1 |
| Literature: Wagner, Edwin Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 131 - 139 |