ethyl 1,3-dimethyl-5-phenylpyrazole-4-carboxylate structure
|
Common Name | ethyl 1,3-dimethyl-5-phenylpyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 77435-42-8 | Molecular Weight | 244.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1,3-dimethyl-5-phenylpyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 44.12000 |
| LogP | 2.57220 |
| InChIKey | XEWSVZCAYCGEBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)nn(C)c1-c1ccccc1 |
|
~%
ethyl 1,3-dimet... CAS#:77435-42-8 |
| Literature: Al-Saleh, Fowzia S.; Khawaja, Ibtisam K. Al; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 642 - 645 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Pyrazole-4-carboxylic acid,1,3-dimethyl-5-phenyl-,ethyl ester |
| ETHYL 1,3-DIMETHYL-5-PHENYL-1H-PYRAZOLE-4-CARBOXYLATE |