ethyl 1,3-dimethyl-5-(morpholin-4-ylmethylidene)-4-oxo-6,7-dihydroindole-2-carboxylate structure
|
Common Name | ethyl 1,3-dimethyl-5-(morpholin-4-ylmethylidene)-4-oxo-6,7-dihydroindole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 84990-07-8 | Molecular Weight | 332.39400 | |
| Density | 1.26g/cm3 | Boiling Point | 525.7ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.7ºC | |
| Name | ethyl (5E)-1,3-dimethyl-5-(morpholin-4-ylmethylidene)-4-oxo-6,7-dihydroindole-2-carboxylate |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 525.7ºC at 760 mmHg |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.39400 |
| Flash Point | 271.7ºC |
| Exact Mass | 332.17400 |
| PSA | 60.77000 |
| LogP | 1.79310 |
| Index of Refraction | 1.596 |
| InChIKey | JGCDAFFZSYNMJK-ACCUITESSA-N |
| SMILES | CCOC(=O)c1c(C)c2c(n1C)CCC(=CN1CCOCC1)C2=O |
|
~92%
ethyl 1,3-dimet... CAS#:84990-07-8 |
| Literature: Singh, Rajeshwar; Bhagavateeswaran, H.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 9 p. 853 - 856 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |